CAS 32385-21-0 is the registry number for (5,5'-Biindan)-1,1',3,3'-tetrone. Offered by: TRC. Available pack sizes: 100mg.
5-(1,3-dioxoinden-5-yl)indene-1,3-dione (CAS 32385-21-0) is a chemical compound with the molecular formula C18H10O4 and a molecular weight of 290.3 g/mol. IUPAC name: 5-(1,3-dioxoinden-5-yl)indene-1,3-dione. InChIKey: FZRWSMCCAPTQBD-UHFFFAOYSA-N.
| Molecular formula | C18H10O4 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 5-(1,3-dioxoinden-5-yl)indene-1,3-dione |
| InChIKey | FZRWSMCCAPTQBD-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C1=O)C=C(C=C2)C3=CC4=C(C=C3)C(=O)CC4=O |
Computed by PubChem (NCBI)