CAS 110322-88-8 appears in our catalog under these names: 1-(2-Chloro-4-fluoro-5-nitro-phenyl)-ethanone, 95%, 1-(2-Chloro-4-fluoro-5-nitrophenyl)ethanone 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
1-(2-chloro-4-fluoro-5-nitrophenyl)ethanone (CAS 110322-88-8) is a chemical compound with the molecular formula C8H5ClFNO3 and a molecular weight of 217.58 g/mol. IUPAC name: 1-(2-chloro-4-fluoro-5-nitrophenyl)ethanone. InChIKey: CVSAKTUCZGZYML-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO3 |
|---|---|
| Molecular weight | 217.58 g/mol |
| IUPAC name | 1-(2-chloro-4-fluoro-5-nitrophenyl)ethanone |
| InChIKey | CVSAKTUCZGZYML-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)