Products 2750929-50-9
CAS 2750929-50-9 is the registry number for Methyl 2-chloro-5-fluoro-6-formylnicotinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chloro-5-fluoro-6-formylpyridine-3-carboxylate (CAS 2750929-50-9) is a chemical compound with the molecular formula C8H5ClFNO3 and a molecular weight of 217.58 g/mol. IUPAC name: methyl 2-chloro-5-fluoro-6-formylpyridine-3-carboxylate. InChIKey: BGXAXAOEVPSZJW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO3 |
|---|---|
| Molecular weight | 217.58 g/mol |
| IUPAC name | methyl 2-chloro-5-fluoro-6-formylpyridine-3-carboxylate |
| InChIKey | BGXAXAOEVPSZJW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1Cl)C=O)F |
Computed by PubChem (NCBI)