CAS 1539494-36-4 is the registry number for 2-Chloro-1-(2-fluoro-4-nitrophenyl)ethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-1-(2-fluoro-4-nitrophenyl)ethanone (CAS 1539494-36-4) is a chemical compound with the molecular formula C8H5ClFNO3 and a molecular weight of 217.58 g/mol. IUPAC name: 2-chloro-1-(2-fluoro-4-nitrophenyl)ethanone. InChIKey: ANVDDLQWGQOGOR-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFNO3 |
|---|---|
| Molecular weight | 217.58 g/mol |
| IUPAC name | 2-chloro-1-(2-fluoro-4-nitrophenyl)ethanone |
| InChIKey | ANVDDLQWGQOGOR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])F)C(=O)CCl |
Computed by PubChem (NCBI)