Products 1103316-49-9
CAS 1103316-49-9 is the registry number for (2S)-2-(2-(1H-1,2,3,4-Tetrazol-1-yl)acetamido)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S)-2-[[2-(tetrazol-1-yl)acetyl]amino]propanoic acid (CAS 1103316-49-9) is a chemical compound with the molecular formula C6H9N5O3 and a molecular weight of 199.17 g/mol. IUPAC name: (2S)-2-[[2-(tetrazol-1-yl)acetyl]amino]propanoic acid. InChIKey: XHYOKIAVUYPKEJ-BYPYZUCNSA-N.
| Molecular formula | C6H9N5O3 |
|---|---|
| Molecular weight | 199.17 g/mol |
| IUPAC name | (2S)-2-[[2-(tetrazol-1-yl)acetyl]amino]propanoic acid |
| InChIKey | XHYOKIAVUYPKEJ-BYPYZUCNSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)CN1C=NN=N1 |
Computed by PubChem (NCBI)