CAS 1119452-03-7 is the registry number for 3-(Aminomethyl)-n-(2-amino-2-oxoethyl)-1,2,4-oxadiazole-5-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(aminomethyl)-N-(2-amino-2-oxoethyl)-1,2,4-oxadiazole-5-carboxamide (CAS 1119452-03-7) is a chemical compound with the molecular formula C6H9N5O3 and a molecular weight of 199.17 g/mol. IUPAC name: 3-(aminomethyl)-N-(2-amino-2-oxoethyl)-1,2,4-oxadiazole-5-carboxamide. InChIKey: XCUMRZHXTCETJB-UHFFFAOYSA-N.
| Molecular formula | C6H9N5O3 |
|---|---|
| Molecular weight | 199.17 g/mol |
| IUPAC name | 3-(aminomethyl)-N-(2-amino-2-oxoethyl)-1,2,4-oxadiazole-5-carboxamide |
| InChIKey | XCUMRZHXTCETJB-UHFFFAOYSA-N |
| SMILES | C(C1=NOC(=N1)C(=O)NCC(=O)N)N |
Computed by PubChem (NCBI)