Products 2241145-56-0
CAS 2241145-56-0 is the registry number for Methyl 1-((N'-hydroxycarbamimidoyl)methyl)-1H-1,2,3-triazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 1-[(2Z)-2-amino-2-hydroxyiminoethyl]triazole-4-carboxylate (CAS 2241145-56-0) is a chemical compound with the molecular formula C6H9N5O3 and a molecular weight of 199.17 g/mol. IUPAC name: methyl 1-[(2Z)-2-amino-2-hydroxyiminoethyl]triazole-4-carboxylate. InChIKey: NEMUIBWGNIYFSV-UHFFFAOYSA-N.
| Molecular formula | C6H9N5O3 |
|---|---|
| Molecular weight | 199.17 g/mol |
| IUPAC name | methyl 1-[(2Z)-2-amino-2-hydroxyiminoethyl]triazole-4-carboxylate |
| InChIKey | NEMUIBWGNIYFSV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN(N=N1)C/C(=N/O)/N |
Computed by PubChem (NCBI)