CAS 110371-28-3 appears in our catalog under these names: 5-(Methoxycarbonyl)bicyclo[3.1.1]heptane-1-carboxylic acid, 95%, 5-(Methoxycarbonyl)bicyclo[3.1.1]heptane-1-carboxylic Acid, >98.0%(qNMR), 5-(Methoxycarbonyl)bicyclo(3.1.1)heptane-1-carboxylic acid, 5-(Methoxycarbonyl)bicyclo[3.1.1]heptane-1-carboxylic acid 97%, 5-(Methoxycarbonyl)bicyclo[3.1.1]heptane-1-carboxylic Acid, 97%, 97%. Offered by: Combi-blocks, TCI, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 200mg, 0,5g, 50mg, 100mg, 5g, 500mg.
5-methoxycarbonylbicyclo[3.1.1]heptane-1-carboxylic acid (CAS 110371-28-3) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: 5-methoxycarbonylbicyclo[3.1.1]heptane-1-carboxylic acid. InChIKey: XBHAKHGDPDKVAY-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 5-methoxycarbonylbicyclo[3.1.1]heptane-1-carboxylic acid |
| InChIKey | XBHAKHGDPDKVAY-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CCCC(C1)(C2)C(=O)O |
Computed by PubChem (NCBI)