CAS 4841-84-3 appears in our catalog under these names: Dimethyl cis-1,2,3,6-tetrahydrophthalate, 96%, Dimethyl cis–4–Cyclohexene–1,2–dicarboxylate, Dimethyl cis-4-Cyclohexene-1,2-dicarboxylate, >97.0%(GC), cis-Dimethyl cyclohex-4-ene-1,2-dicarboxylate 97%, 4-Cyclohexene-1,2-dicarboxylic acid, dimethyl ester, (1R,2S)-rel-, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg.
Dimethyl (1S,2R)-cyclohex-4-ene-1,2-dicarboxylate (CAS 4841-84-3) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: dimethyl (1S,2R)-cyclohex-4-ene-1,2-dicarboxylate. InChIKey: DVVAGRMJGUQHLI-OCAPTIKFSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | dimethyl (1S,2R)-cyclohex-4-ene-1,2-dicarboxylate |
| InChIKey | DVVAGRMJGUQHLI-OCAPTIKFSA-N |
| SMILES | COC(=O)[C@@H]1CC=CC[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)