Products 925-16-6
CAS 925-16-6 appears in our catalog under these names: Diallyl succinate, 95%, Diallyl Succinate. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 0,5g, 2g.
Bis(prop-2-enyl) butanedioate (CAS 925-16-6) is a chemical compound with the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. IUPAC name: bis(prop-2-enyl) butanedioate. InChIKey: HABAXTXIECRCKH-UHFFFAOYSA-N.
| Molecular formula | C10H14O4 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | bis(prop-2-enyl) butanedioate |
| InChIKey | HABAXTXIECRCKH-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)CCC(=O)OCC=C |
Computed by PubChem (NCBI)
Synonyms:
Diallyl succinate, Butanedioic acid, di-2-propenyl ester, Succinic acid, diallyl ester, Butanoic acid, di-2-propenyl ester, Butanedioic acid, 1,4-di-2-propen-1-yl ester, InChI=1/C10H14O4/c1-3-7-13-9(11)5-6-10(12)14-8-4-2/h3-4H,1-2,5-8H, bis(prop-2-enyl) butanedioate, Diallylsuccinate, diallyl butanedioate, 1,4-bis(prop-2-en-1-yl) butanedioate