Products 1104386-11-9
CAS 1104386-11-9 appears in our catalog under these names: (S)-1-(2-Methyl-2-phenylpropanoyl)pyrrolidine-2-carboxylic acid, 98%, 98%, (2S)-1-(2-methyl-2-phenyl-propanoyl)pyrrolidine-2-carboxylic acid, 98%, (S)-1-(2-Methyl-2-phenylpropanoyl)pyrrolidine-2-carboxylic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2S)-1-(2-methyl-2-phenylpropanoyl)pyrrolidine-2-carboxylic acid (CAS 1104386-11-9) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: (2S)-1-(2-methyl-2-phenylpropanoyl)pyrrolidine-2-carboxylic acid. InChIKey: ADLNTEZHEXTYPQ-LBPRGKRZSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | (2S)-1-(2-methyl-2-phenylpropanoyl)pyrrolidine-2-carboxylic acid |
| InChIKey | ADLNTEZHEXTYPQ-LBPRGKRZSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C(=O)N2CCC[C@H]2C(=O)O |
Computed by PubChem (NCBI)