CAS 1104636-72-7 appears in our catalog under these names: 4-Pyridinylboronic acid mida ester, 95%, 4-Pyridinylboronic acid MIDA ester 97%, 4-Pyridinylboronic acid MIDA ester, 97%, 97%, PYRIDINE-4-BORONIC ACID MIDA ESTER, ≥95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g.
6-methyl-2-pyridin-4-yl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1104636-72-7) is a chemical compound with the molecular formula C10H11BN2O4 and a molecular weight of 234.02 g/mol. IUPAC name: 6-methyl-2-pyridin-4-yl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: FVUPUWZQLRQASU-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O4 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 6-methyl-2-pyridin-4-yl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | FVUPUWZQLRQASU-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC=NC=C2 |
Computed by PubChem (NCBI)