Products 2761204-50-4
CAS 2761204-50-4 is the registry number for (7-Methoxy-2-methyl-1-oxo-1,2-dihydrophthalazin-6-yl)boronic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(7-methoxy-2-methyl-1-oxophthalazin-6-yl)boronic acid (CAS 2761204-50-4) is a chemical compound with the molecular formula C10H11BN2O4 and a molecular weight of 234.02 g/mol. IUPAC name: (7-methoxy-2-methyl-1-oxophthalazin-6-yl)boronic acid. InChIKey: DBHNQTRNOBFVPD-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O4 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | (7-methoxy-2-methyl-1-oxophthalazin-6-yl)boronic acid |
| InChIKey | DBHNQTRNOBFVPD-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1OC)C(=O)N(N=C2)C)(O)O |
Computed by PubChem (NCBI)