CAS 1311484-51-1 appears in our catalog under these names: 3-Pyridineboronic acid mida ester, 95%, 4-Methyl-2,6-dioxo-8-(pyridin-3-yl)hexahydro-(1,3,2)oxazaborolo(2,3-b)(1,3,2)oxazaborol-4-ium-8-uide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-methyl-2-pyridin-3-yl-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1311484-51-1) is a chemical compound with the molecular formula C10H11BN2O4 and a molecular weight of 234.02 g/mol. IUPAC name: 6-methyl-2-pyridin-3-yl-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: QJEDFNBMCXNWRT-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O4 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 6-methyl-2-pyridin-3-yl-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | QJEDFNBMCXNWRT-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CN=CC=C2 |
Computed by PubChem (NCBI)