Products 110473-10-4

CAS 110473-10-4 is the registry number for Boc-d-glu(obzl)-ome, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-O-benzyl 1-O-methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (CAS 110473-10-4) is a chemical compound with the molecular formula C18H25NO6 and a molecular weight of 351.4 g/mol. IUPAC name: 5-O-benzyl 1-O-methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate. InChIKey: KHCZTGSAKNZBOV-CQSZACIVSA-N.

Identity
Molecular formulaC18H25NO6
Molecular weight351.4 g/mol
IUPAC name5-O-benzyl 1-O-methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate
InChIKeyKHCZTGSAKNZBOV-CQSZACIVSA-N
SMILESCC(C)(C)OC(=O)N[C@H](CCC(=O)OCC1=CC=CC=C1)C(=O)OC

Computed by PubChem (NCBI)