CAS 200615-91-4 appears in our catalog under these names: Boc-n-me-glu(obzl)-oh, 95%, Boc–N–Me–Glu(Obzl)–OH, Boc-N-Me-Glu(Obzl)-OH, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxo-5-phenylmethoxypentanoic acid (CAS 200615-91-4) is a chemical compound with the molecular formula C18H25NO6 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: NEJPFSNBCOTZHN-AWEZNQCLSA-N.
| Molecular formula | C18H25NO6 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | NEJPFSNBCOTZHN-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H](CCC(=O)OCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)