CAS 56877-41-9 appears in our catalog under these names: Z-Glu(OtBu)-OMe, 98%, Z–Glu(OtBu)–OMe, Cbz-Glu(OtBu)-OMe 98%, Z-Glu(OtBu)-OMe, 98%, 98%, Z-L-glutamic acid g-tert-butyl ester a-methyl ester, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 1g.
5-O-tert-butyl 1-O-methyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate (CAS 56877-41-9) is a chemical compound with the molecular formula C18H25NO6 and a molecular weight of 351.4 g/mol. IUPAC name: 5-O-tert-butyl 1-O-methyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate. InChIKey: BRMSLIYSWUEHJT-AWEZNQCLSA-N.
| Molecular formula | C18H25NO6 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 5-O-tert-butyl 1-O-methyl (2S)-2-(phenylmethoxycarbonylamino)pentanedioate |
| InChIKey | BRMSLIYSWUEHJT-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)