CAS 1104927-34-5 is the registry number for 5-Methyl-4-oxo-4,5-dihydroisoxazolo[5,4-d]pyrimidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-methyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid (CAS 1104927-34-5) is a chemical compound with the molecular formula C7H5N3O4 and a molecular weight of 195.13 g/mol. IUPAC name: 5-methyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid. InChIKey: UCEPHUOIZFUAJA-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O4 |
|---|---|
| Molecular weight | 195.13 g/mol |
| IUPAC name | 5-methyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidine-3-carboxylic acid |
| InChIKey | UCEPHUOIZFUAJA-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(C1=O)C(=NO2)C(=O)O |
Computed by PubChem (NCBI)