Products 337463-64-6
CAS 337463-64-6 appears in our catalog under these names: 6-Nitro-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one, 95%, 95%, 6-Nitro-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6-nitro-4H-pyrido[3,2-b][1,4]oxazin-3-one (CAS 337463-64-6) is a chemical compound with the molecular formula C7H5N3O4 and a molecular weight of 195.13 g/mol. IUPAC name: 6-nitro-4H-pyrido[3,2-b][1,4]oxazin-3-one. InChIKey: JANHQSAAMLBUOH-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O4 |
|---|---|
| Molecular weight | 195.13 g/mol |
| IUPAC name | 6-nitro-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| InChIKey | JANHQSAAMLBUOH-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)