CAS 18333-74-9 is the registry number for 5-Methoxy-4-nitrobenzo[c][1,2,5]oxadiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methoxy-4-nitro-2,1,3-benzoxadiazole (CAS 18333-74-9) is a chemical compound with the molecular formula C7H5N3O4 and a molecular weight of 195.13 g/mol. IUPAC name: 5-methoxy-4-nitro-2,1,3-benzoxadiazole. InChIKey: VACFBPICLQYYBY-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O4 |
|---|---|
| Molecular weight | 195.13 g/mol |
| IUPAC name | 5-methoxy-4-nitro-2,1,3-benzoxadiazole |
| InChIKey | VACFBPICLQYYBY-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=NON=C2C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)