CAS 1105039-93-7 appears in our catalog under these names: 1–(4–Methoxybenzyl)–1H–pyrazole–4–carboxylic acid, 1-(4-Methoxybenzyl)-1H-pyrazole-4-carboxylic acid, 1-(4-Methoxybenzyl)-1H-pyrazole-4-carboxylic acid, 98%, 98%, 1-(4-Methoxybenzyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
1-[(4-methoxyphenyl)methyl]pyrazole-4-carboxylic acid (CAS 1105039-93-7) is a chemical compound with the molecular formula C12H12N2O3 and a molecular weight of 232.23 g/mol. IUPAC name: 1-[(4-methoxyphenyl)methyl]pyrazole-4-carboxylic acid. InChIKey: JMWJJDKQQMMJRG-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 1-[(4-methoxyphenyl)methyl]pyrazole-4-carboxylic acid |
| InChIKey | JMWJJDKQQMMJRG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)