CAS 1105045-66-6 is the registry number for 3-(3-Bromophenyl)-2-({((9h-fluoren-9-yl)methoxy)carbonyl}amino)propanoic Acid. Offered by: TRC. Available pack sizes: 250mg.
3-(3-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1105045-66-6) is a chemical compound with the molecular formula C24H20BrNO4 and a molecular weight of 466.3 g/mol. IUPAC name: 3-(3-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: CALGTIKYXVBTAO-UHFFFAOYSA-N.
| Molecular formula | C24H20BrNO4 |
|---|---|
| Molecular weight | 466.3 g/mol |
| IUPAC name | 3-(3-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | CALGTIKYXVBTAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC(=CC=C4)Br)C(=O)O |
Computed by PubChem (NCBI)