CAS 1105045-80-4 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2,4-dichlorophenyl)propanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1105045-80-4) is a chemical compound with the molecular formula C24H19Cl2NO4 and a molecular weight of 456.3 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: PGIMVGROPOKRNA-UHFFFAOYSA-N.
| Molecular formula | C24H19Cl2NO4 |
|---|---|
| Molecular weight | 456.3 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | PGIMVGROPOKRNA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=C(C=C(C=C4)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)