CAS 177966-58-4 appears in our catalog under these names: Fmoc–3,4–dichloro–D–Phe–OH, Fmoc-D-Phe(3,4-Cl2)-OH, Fmoc-D-Phe(3,4-DiCl)-OH 95%, Fmoc-D-Phe(3,4-DiCl)-OH, 95%, 95%, Fmoc-D-Phe(3,4-DiCl)-OH, 98.98%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100g, 5 g, 1 g.
(2R)-3-(3,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 177966-58-4) is a chemical compound with the molecular formula C24H19Cl2NO4 and a molecular weight of 456.3 g/mol. IUPAC name: (2R)-3-(3,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: QNVHCYWPXIGFGN-JOCHJYFZSA-N.
| Molecular formula | C24H19Cl2NO4 |
|---|---|
| Molecular weight | 456.3 g/mol |
| IUPAC name | (2R)-3-(3,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | QNVHCYWPXIGFGN-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=C(C=C4)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)