CAS 17766-59-5 is the registry number for Fmoc-Phe(3,4-DiCl)-OH, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(2S)-3-(3,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 17766-59-5) is a chemical compound with the molecular formula C24H19Cl2NO4 and a molecular weight of 456.3 g/mol. IUPAC name: (2S)-3-(3,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: QNVHCYWPXIGFGN-QFIPXVFZSA-N.
| Molecular formula | C24H19Cl2NO4 |
|---|---|
| Molecular weight | 456.3 g/mol |
| IUPAC name | (2S)-3-(3,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | QNVHCYWPXIGFGN-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=C(C=C4)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)