CAS 1105189-44-3 is the registry number for 1-(3,4-dimethylphenyl)-6-mercapto-1,5-dihydro-4h-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: TRC. Available pack sizes: 750mg.
1-(3,4-dimethylphenyl)-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1105189-44-3) is a chemical compound with the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: YJTAIPUMCQAFMH-UHFFFAOYSA-N.
| Molecular formula | C13H12N4OS |
|---|---|
| Molecular weight | 272.33 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)-6-sulfanylidene-7H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | YJTAIPUMCQAFMH-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C3=C(C=N2)C(=O)NC(=S)N3)C |
Computed by PubChem (NCBI)