CAS 1334492-37-3 is the registry number for 6-(3,5-Dimethylphenoxy)[1,2,4]triazolo[4,3-b]pyridazine-3(2h)-thione, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
6-(3,5-dimethylphenoxy)-2H-[1,2,4]triazolo[4,3-b]pyridazine-3-thione (CAS 1334492-37-3) is a chemical compound with the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. IUPAC name: 6-(3,5-dimethylphenoxy)-2H-[1,2,4]triazolo[4,3-b]pyridazine-3-thione. InChIKey: WWUWXYRLFKMXFY-UHFFFAOYSA-N.
| Molecular formula | C13H12N4OS |
|---|---|
| Molecular weight | 272.33 g/mol |
| IUPAC name | 6-(3,5-dimethylphenoxy)-2H-[1,2,4]triazolo[4,3-b]pyridazine-3-thione |
| InChIKey | WWUWXYRLFKMXFY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OC2=NN3C(=NNC3=S)C=C2)C |
Computed by PubChem (NCBI)