Products 937681-88-4
CAS 937681-88-4 appears in our catalog under these names: 4-Ethyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine, 95%, 4-Ethyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)thiazol-2-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-ethyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine (CAS 937681-88-4) is a chemical compound with the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. IUPAC name: 4-ethyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine. InChIKey: ZFIKXFQTLDLNOF-UHFFFAOYSA-N.
| Molecular formula | C13H12N4OS |
|---|---|
| Molecular weight | 272.33 g/mol |
| IUPAC name | 4-ethyl-5-(3-phenyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-amine |
| InChIKey | ZFIKXFQTLDLNOF-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC(=N1)N)C2=NC(=NO2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)