CAS 1105190-90-6 is the registry number for (5-Oxo-2,3,6,7,8,9-hexahydro-5H-(1,3)thiazolo(2,3-b)quinazolin-3-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-oxo-2,3,6,7,8,9-hexahydro-[1,3]thiazolo[2,3-b]quinazolin-3-yl)acetic acid (CAS 1105190-90-6) is a chemical compound with the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. IUPAC name: 2-(5-oxo-2,3,6,7,8,9-hexahydro-[1,3]thiazolo[2,3-b]quinazolin-3-yl)acetic acid. InChIKey: WKBCPRLIIIVMBL-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3S |
|---|---|
| Molecular weight | 266.32 g/mol |
| IUPAC name | 2-(5-oxo-2,3,6,7,8,9-hexahydro-[1,3]thiazolo[2,3-b]quinazolin-3-yl)acetic acid |
| InChIKey | WKBCPRLIIIVMBL-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)N3C(CSC3=N2)CC(=O)O |
Computed by PubChem (NCBI)