Products 1105192-19-5

CAS 1105192-19-5 is the registry number for 1-(4-Fluorobenzyl)-6-oxo-1,6-dihydropyridazine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

1-[(4-fluorophenyl)methyl]-6-oxopyridazine-3-carboxylic acid (CAS 1105192-19-5) is a chemical compound with the molecular formula C12H9FN2O3 and a molecular weight of 248.21 g/mol. IUPAC name: 1-[(4-fluorophenyl)methyl]-6-oxopyridazine-3-carboxylic acid. InChIKey: INRDWHCKWFIXSK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9FN2O3
Molecular weight248.21 g/mol
IUPAC name1-[(4-fluorophenyl)methyl]-6-oxopyridazine-3-carboxylic acid
InChIKeyINRDWHCKWFIXSK-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CN2C(=O)C=CC(=N2)C(=O)O)F

Computed by PubChem (NCBI)