Products 869634-08-2
CAS 869634-08-2 is the registry number for 1-(2-Fluorophenyl)-6-methyl-4-oxo-1,4-dihydropyridazine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxylic acid (CAS 869634-08-2) is a chemical compound with the molecular formula C12H9FN2O3 and a molecular weight of 248.21 g/mol. IUPAC name: 1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxylic acid. InChIKey: OWVLQYNNEXUSHO-UHFFFAOYSA-N.
| Molecular formula | C12H9FN2O3 |
|---|---|
| Molecular weight | 248.21 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-6-methyl-4-oxopyridazine-3-carboxylic acid |
| InChIKey | OWVLQYNNEXUSHO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=NN1C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)