CAS 2623102-65-6 is the registry number for 3-(6-Fluorobenzo[d]isoxazol-3-yl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(6-fluoro-1,2-benzoxazol-3-yl)piperidine-2,6-dione (CAS 2623102-65-6) is a chemical compound with the molecular formula C12H9FN2O3 and a molecular weight of 248.21 g/mol. IUPAC name: 3-(6-fluoro-1,2-benzoxazol-3-yl)piperidine-2,6-dione. InChIKey: AFJIMMUTIWDEIF-UHFFFAOYSA-N.
| Molecular formula | C12H9FN2O3 |
|---|---|
| Molecular weight | 248.21 g/mol |
| IUPAC name | 3-(6-fluoro-1,2-benzoxazol-3-yl)piperidine-2,6-dione |
| InChIKey | AFJIMMUTIWDEIF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=NOC3=C2C=CC(=C3)F |
Computed by PubChem (NCBI)