Products 129214-59-1
CAS 129214-59-1 is the registry number for 15-Dihydroepioxylubimin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
(3R,5R,6S,7R,8R,10R)-10-(hydroxymethyl)-6-methyl-3-prop-1-en-2-ylspiro[4.5]decane-7,8-diol (CAS 129214-59-1) is a chemical compound with the molecular formula C15H26O3 and a molecular weight of 254.36 g/mol. IUPAC name: (3R,5R,6S,7R,8R,10R)-10-(hydroxymethyl)-6-methyl-3-prop-1-en-2-ylspiro[4.5]decane-7,8-diol. InChIKey: NPIIWZCGVADPIE-KYFQHEKYSA-N.
| Molecular formula | C15H26O3 |
|---|---|
| Molecular weight | 254.36 g/mol |
| IUPAC name | (3R,5R,6S,7R,8R,10R)-10-(hydroxymethyl)-6-methyl-3-prop-1-en-2-ylspiro[4.5]decane-7,8-diol |
| InChIKey | NPIIWZCGVADPIE-KYFQHEKYSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H](C[C@H]([C@]12CC[C@H](C2)C(=C)C)CO)O)O |
Computed by PubChem (NCBI)
Synonyms:
15-Dihydroepioxylubimin, orb1683884