CAS 110567-94-7 is the registry number for 4,5-Diphenyl-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,5-diphenyl-1H-pyridin-2-one (CAS 110567-94-7) is a chemical compound with the molecular formula C17H13NO and a molecular weight of 247.29 g/mol. IUPAC name: 4,5-diphenyl-1H-pyridin-2-one. InChIKey: FUVPZUMEUQIXDY-UHFFFAOYSA-N.
| Molecular formula | C17H13NO |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 4,5-diphenyl-1H-pyridin-2-one |
| InChIKey | FUVPZUMEUQIXDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)NC=C2C3=CC=CC=C3 |
Computed by PubChem (NCBI)