CAS 110657-98-2 appears in our catalog under these names: (5S,6R,7E,9E,11Z,13E,15S,17Z)-5,6,15-Trihydroxyicosa-7,9,11,13,17-pentaenoic acid, 97%, Lipoxin A5, Lipoxin A5. Offered by: Chemat Brand, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 25ug, 50ug, 100ug, 100μg, 25μg, 50μg, 100 μg.
(5S,6R,7E,9E,11Z,13E,15S,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoic acid (CAS 110657-98-2) is a chemical compound with the molecular formula C20H30O5 and a molecular weight of 350.4 g/mol. IUPAC name: (5S,6R,7E,9E,11Z,13E,15S,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoic acid. InChIKey: ZZMKOZNTEJVKRY-YJUORNCYSA-N.
| Molecular formula | C20H30O5 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | (5S,6R,7E,9E,11Z,13E,15S,17Z)-5,6,15-trihydroxyicosa-7,9,11,13,17-pentaenoic acid |
| InChIKey | ZZMKOZNTEJVKRY-YJUORNCYSA-N |
| SMILES | CC/C=C\C[C@@H](/C=C/C=C\C=C\C=C\[C@H]([C@H](CCCC(=O)O)O)O)O |
Computed by PubChem (NCBI)