CAS 93551-00-9 appears in our catalog under these names: 17-Hydroxyisolathyrol, 17-Hydroxyisolathyrol, 99.23% ,, 99.23% ,, 17-Hydroxyisolathyrol, 99.33%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 10 mg.
(3Z,9Z)-1,11,13-trihydroxy-10-(hydroxymethyl)-3,6,6,14-tetramethyltricyclo[10.3.0.05,7]pentadeca-3,9-dien-2-one (CAS 93551-00-9) is a chemical compound with the molecular formula C20H30O5 and a molecular weight of 350.4 g/mol. IUPAC name: (3Z,9Z)-1,11,13-trihydroxy-10-(hydroxymethyl)-3,6,6,14-tetramethyltricyclo[10.3.0.05,7]pentadeca-3,9-dien-2-one. InChIKey: XKXYJTIBKZGIPR-YDYNUCMUSA-N.
| Molecular formula | C20H30O5 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | (3Z,9Z)-1,11,13-trihydroxy-10-(hydroxymethyl)-3,6,6,14-tetramethyltricyclo[10.3.0.05,7]pentadeca-3,9-dien-2-one |
| InChIKey | XKXYJTIBKZGIPR-YDYNUCMUSA-N |
| SMILES | CC1CC2(C(C1O)C(/C(=C\CC3C(C3(C)C)/C=C(\C2=O)/C)/CO)O)O |
Computed by PubChem (NCBI)