CAS 71902-47-1 appears in our catalog under these names: Prostaglandin D3, Prostaglandin D3. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 25ug, 50ug, 100ug, 100μg, 25μg, 50μg, 25 μg.
(Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(1E,3S,5Z)-3-hydroxyocta-1,5-dienyl]-3-oxocyclopentyl]hept-5-enoic acid (CAS 71902-47-1) is a chemical compound with the molecular formula C20H30O5 and a molecular weight of 350.4 g/mol. IUPAC name: (Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(1E,3S,5Z)-3-hydroxyocta-1,5-dienyl]-3-oxocyclopentyl]hept-5-enoic acid. InChIKey: ANOICLBSJIMQTA-WXGBOJPQSA-N.
| Molecular formula | C20H30O5 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | (Z)-7-[(1R,2R,5S)-5-hydroxy-2-[(1E,3S,5Z)-3-hydroxyocta-1,5-dienyl]-3-oxocyclopentyl]hept-5-enoic acid |
| InChIKey | ANOICLBSJIMQTA-WXGBOJPQSA-N |
| SMILES | CC/C=C\C[C@@H](/C=C/[C@@H]1[C@H]([C@H](CC1=O)O)C/C=C\CCCC(=O)O)O |
Computed by PubChem (NCBI)