CAS 110744-90-6 appears in our catalog under these names: 2-[(Benzyloxy)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%, 2-((Benzyloxy)methyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4,4,5,5-tetramethyl-2-(phenylmethoxymethyl)-1,3,2-dioxaborolane (CAS 110744-90-6) is a chemical compound with the molecular formula C14H21BO3 and a molecular weight of 248.13 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(phenylmethoxymethyl)-1,3,2-dioxaborolane. InChIKey: DDCLNADXCHSLRO-UHFFFAOYSA-N.
| Molecular formula | C14H21BO3 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(phenylmethoxymethyl)-1,3,2-dioxaborolane |
| InChIKey | DDCLNADXCHSLRO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)COCC2=CC=CC=C2 |
Computed by PubChem (NCBI)