CAS 110755-73-2 appears in our catalog under these names: (S)-2-(tert-butoxycarbonyl)-2-(methylamino)-4-phenylbutanoic acid, 98%, N-Boc-N-methyl-(S)-homophenylalanine, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-phenylbutanoic acid (CAS 110755-73-2) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-phenylbutanoic acid. InChIKey: YNXLVCPGFCPBNQ-ZDUSSCGKSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-phenylbutanoic acid |
| InChIKey | YNXLVCPGFCPBNQ-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H](CCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)