CAS 1107604-10-3 appears in our catalog under these names: 3,5-Dichloro-4-ethoxyphenylboronic acid, 97%, 3,5–Dichloro–4–ethoxyphenylboronic acid, (3,5-Dichloro-4-ethoxyphenyl)boronic acid. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg.
(3,5-dichloro-4-ethoxyphenyl)boronic acid (CAS 1107604-10-3) is a chemical compound with the molecular formula C8H9BCl2O3 and a molecular weight of 234.87 g/mol. IUPAC name: (3,5-dichloro-4-ethoxyphenyl)boronic acid. InChIKey: IZNJKZLGWKWHGT-UHFFFAOYSA-N.
| Molecular formula | C8H9BCl2O3 |
|---|---|
| Molecular weight | 234.87 g/mol |
| IUPAC name | (3,5-dichloro-4-ethoxyphenyl)boronic acid |
| InChIKey | IZNJKZLGWKWHGT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OCC)Cl)(O)O |
Computed by PubChem (NCBI)