Products 1107604-10-3

CAS 1107604-10-3 appears in our catalog under these names: 3,5-Dichloro-4-ethoxyphenylboronic acid, 97%, 3,5–Dichloro–4–ethoxyphenylboronic acid, (3,5-Dichloro-4-ethoxyphenyl)boronic acid. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(3,5-dichloro-4-ethoxyphenyl)boronic acid (CAS 1107604-10-3) is a chemical compound with the molecular formula C8H9BCl2O3 and a molecular weight of 234.87 g/mol. IUPAC name: (3,5-dichloro-4-ethoxyphenyl)boronic acid. InChIKey: IZNJKZLGWKWHGT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9BCl2O3
Molecular weight234.87 g/mol
IUPAC name(3,5-dichloro-4-ethoxyphenyl)boronic acid
InChIKeyIZNJKZLGWKWHGT-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)Cl)OCC)Cl)(O)O

Computed by PubChem (NCBI)