Products 2121514-11-0
CAS 2121514-11-0 appears in our catalog under these names: 3,5-Dichloro-4-(methoxymethyl)phenylboronic acid, 95%, 3,5-Dichloro-4-(methoxymethyl)phenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.
[3,5-dichloro-4-(methoxymethyl)phenyl]boronic acid (CAS 2121514-11-0) is a chemical compound with the molecular formula C8H9BCl2O3 and a molecular weight of 234.87 g/mol. IUPAC name: [3,5-dichloro-4-(methoxymethyl)phenyl]boronic acid. InChIKey: IYUOVSMFQZZRRE-UHFFFAOYSA-N.
| Molecular formula | C8H9BCl2O3 |
|---|---|
| Molecular weight | 234.87 g/mol |
| IUPAC name | [3,5-dichloro-4-(methoxymethyl)phenyl]boronic acid |
| InChIKey | IYUOVSMFQZZRRE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)COC)Cl)(O)O |
Computed by PubChem (NCBI)