CAS 2096341-64-7 appears in our catalog under these names: 2,3-Dichloro-4-ethoxyphenylboronic acid, 96%, (2,3-Dichloro-4-ethoxyphenyl)boronic acid 97%, 2,3-DICHLORO-4-ETHOXYPHENYLBORONIC ACID, 97%, 97%, 2,3-Dichloro-4-ethoxyphenylboronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2,3-dichloro-4-ethoxyphenyl)boronic acid (CAS 2096341-64-7) is a chemical compound with the molecular formula C8H9BCl2O3 and a molecular weight of 234.87 g/mol. IUPAC name: (2,3-dichloro-4-ethoxyphenyl)boronic acid. InChIKey: XRGFWZAWBZHWRS-UHFFFAOYSA-N.
| Molecular formula | C8H9BCl2O3 |
|---|---|
| Molecular weight | 234.87 g/mol |
| IUPAC name | (2,3-dichloro-4-ethoxyphenyl)boronic acid |
| InChIKey | XRGFWZAWBZHWRS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC)Cl)Cl)(O)O |
Computed by PubChem (NCBI)