CAS 110768-19-9 appears in our catalog under these names: 2-(4-Fluorophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-(4-Fluorophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 110768-19-9) is a chemical compound with the molecular formula C15H8FNO4 and a molecular weight of 285.23 g/mol. IUPAC name: 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: JVIPLYCGEZUBIO-UHFFFAOYSA-N.
| Molecular formula | C15H8FNO4 |
|---|---|
| Molecular weight | 285.23 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | JVIPLYCGEZUBIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O)F |
Computed by PubChem (NCBI)