CAS 299963-58-9 is the registry number for 4-(5-Fluoro-1,3-dioxoisoindolin-2-yl)benzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
4-(5-fluoro-1,3-dioxoisoindol-2-yl)benzoic acid (CAS 299963-58-9) is a chemical compound with the molecular formula C15H8FNO4 and a molecular weight of 285.23 g/mol. IUPAC name: 4-(5-fluoro-1,3-dioxoisoindol-2-yl)benzoic acid. InChIKey: UCLKEKHQIWCOQF-UHFFFAOYSA-N.
| Molecular formula | C15H8FNO4 |
|---|---|
| Molecular weight | 285.23 g/mol |
| IUPAC name | 4-(5-fluoro-1,3-dioxoisoindol-2-yl)benzoic acid |
| InChIKey | UCLKEKHQIWCOQF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N2C(=O)C3=C(C2=O)C=C(C=C3)F |
Computed by PubChem (NCBI)