CAS 305359-06-2 appears in our catalog under these names: 1,3-Dioxoisoindolin-2-yl 4-fluorobenzoate, 98%, 1,3-Dioxoisoindolin-2-yl 4-fluorobenzoate, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 50mg, 500mg.
(1,3-dioxoisoindol-2-yl) 4-fluorobenzoate (CAS 305359-06-2) is a chemical compound with the molecular formula C15H8FNO4 and a molecular weight of 285.23 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 4-fluorobenzoate. InChIKey: ZQEDOCXKSFRCGX-UHFFFAOYSA-N.
| Molecular formula | C15H8FNO4 |
|---|---|
| Molecular weight | 285.23 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 4-fluorobenzoate |
| InChIKey | ZQEDOCXKSFRCGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OC(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)