CAS 110772-46-8 appears in our catalog under these names: (R)–2–Amino–3–(furan–2–yl)propanoic acid, (R)-2-Amino-3-(furan-2-yl)propanoic acid, 97%, 97%, (R)-2-Amino-3-(furan-2-yl)propanoic acid, 97.0%, (R)-2-Amino-3-(furan-2-yl)propanoic acid, 97%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 10 g, 1 g, 5 g.
(2R)-2-amino-3-(furan-2-yl)propanoic acid (CAS 110772-46-8) is a chemical compound with the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. IUPAC name: (2R)-2-amino-3-(furan-2-yl)propanoic acid. InChIKey: RXZQHZDTHUUJQJ-ZCFIWIBFSA-N.
| Molecular formula | C7H9NO3 |
|---|---|
| Molecular weight | 155.15 g/mol |
| IUPAC name | (2R)-2-amino-3-(furan-2-yl)propanoic acid |
| InChIKey | RXZQHZDTHUUJQJ-ZCFIWIBFSA-N |
| SMILES | C1=COC(=C1)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)