CAS 121786-31-0 appears in our catalog under these names: L-2-Furylalanine, 98%, (S)–2–Amino–3–(furan–2–yl)propanoic acid, 2-Furanpropanoic acid, α-amino-, (αS)-, 98%, 98%, (S)-2-Amino-3-(furan-2-yl)propanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g, 100mg.
(2S)-2-amino-3-(furan-2-yl)propanoic acid (CAS 121786-31-0) is a chemical compound with the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. IUPAC name: (2S)-2-amino-3-(furan-2-yl)propanoic acid. InChIKey: RXZQHZDTHUUJQJ-LURJTMIESA-N.
| Molecular formula | C7H9NO3 |
|---|---|
| Molecular weight | 155.15 g/mol |
| IUPAC name | (2S)-2-amino-3-(furan-2-yl)propanoic acid |
| InChIKey | RXZQHZDTHUUJQJ-LURJTMIESA-N |
| SMILES | C1=COC(=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)