CAS 110790-10-8 is the registry number for 2-(4-(Benzyloxy)phenyl)ethanamine-d4. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
1,1,2,2-tetradeuterio-2-(4-phenylmethoxyphenyl)ethanamine (CAS 110790-10-8) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 231.33 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(4-phenylmethoxyphenyl)ethanamine. InChIKey: MKKMZZXGIORPMU-MKQHWYKPSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 231.33 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(4-phenylmethoxyphenyl)ethanamine |
| InChIKey | MKKMZZXGIORPMU-MKQHWYKPSA-N |
| SMILES | [2H]C([2H])(C1=CC=C(C=C1)OCC2=CC=CC=C2)C([2H])([2H])N |
Computed by PubChem (NCBI)