CAS 110822-05-4 appears in our catalog under these names: 2-(Bromomethyl)-4-methyl-1-nitrobenzene, 98%, 2-(Bromomethyl)-4-methyl-1-nitrobenzene, 95%, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg, 2.5g, 10g.
2-(bromomethyl)-4-methyl-1-nitrobenzene (CAS 110822-05-4) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-(bromomethyl)-4-methyl-1-nitrobenzene. InChIKey: LBNASNUBBZAFBL-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-(bromomethyl)-4-methyl-1-nitrobenzene |
| InChIKey | LBNASNUBBZAFBL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)