Products 110860-85-0
CAS 110860-85-0 appears in our catalog under these names: 2,3-dichloro-5-(difluoromethoxy)pyridine, 98%, 98%, 2,3-Dichloro-5-(difluoromethoxy)pyridine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,3-dichloro-5-(difluoromethoxy)pyridine (CAS 110860-85-0) is a chemical compound with the molecular formula C6H3Cl2F2NO and a molecular weight of 213.99 g/mol. IUPAC name: 2,3-dichloro-5-(difluoromethoxy)pyridine. InChIKey: NGRHONWFUKCIHG-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2F2NO |
|---|---|
| Molecular weight | 213.99 g/mol |
| IUPAC name | 2,3-dichloro-5-(difluoromethoxy)pyridine |
| InChIKey | NGRHONWFUKCIHG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)Cl)OC(F)F |
Computed by PubChem (NCBI)